For research use only. Not for therapeutic Use.
ASM-IN-1（Cat No.:I041413）is a selective inhibitor of acid sphingomyelinase (ASM), an enzyme involved in the breakdown of sphingomyelin into ceramide, a key lipid involved in cellular signaling. By inhibiting ASM, ASM-IN-1 can modulate sphingolipid metabolism, which plays a critical role in various cellular processes, including cell growth, differentiation, and apoptosis. This compound has potential therapeutic applications in diseases associated with dysregulated sphingolipid metabolism, such as neurodegenerative diseases, cancer, and lysosomal storage disorders. ASM-IN-1 may also have immunomodulatory effects, offering promise for therapeutic interventions in inflammation and autoimmune conditions.
| CAS Number | 2913151-46-7 |
| Synonyms | 3-[4-[(4-bromophenoxy)methyl]phenyl]-N-hydroxy-1,2,4-oxadiazole-5-carboxamide |
| Molecular Formula | C16H12BrN3O4 |
| Purity | ≥95% |
| IUPAC Name | 3-[4-[(4-bromophenoxy)methyl]phenyl]-N-hydroxy-1,2,4-oxadiazole-5-carboxamide |
| InChI | InChI=1S/C16H12BrN3O4/c17-12-5-7-13(8-6-12)23-9-10-1-3-11(4-2-10)14-18-16(24-20-14)15(21)19-22/h1-8,22H,9H2,(H,19,21) |
| InChIKey | YYAPAXZETRKZHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)Br)C3=NOC(=N3)C(=O)NO |
