For research use only. Not for therapeutic Use.
ASN03576800 could be a potent inhibitor for Ebola virus matrix protein VP40 in process of viral assembly and budding process. ASN03576800 occupies the RNA binding region of VP40[1].
| Catalog Number | I012815 |
| CAS Number | 957513-35-8 |
| Synonyms | 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfinylacetic acid |
| Molecular Formula | C11H11NO6S |
| Purity | ≥95% |
| InChI | InChI=1S/C11H11NO6S/c13-10(4-19(16)5-11(14)15)12-7-1-2-8-9(3-7)18-6-17-8/h1-3H,4-6H2,(H,12,13)(H,14,15) |
| InChIKey | ABHAISRFDMHVAA-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)CS(=O)CC(=O)O |
| Reference | [1]. Tamilvanan T, et al. High-throughput virtual screening and docking studies of matrix protein vp40 of ebola virus. Bioinformation. 2013;9(6):286-92. |
