For research use only. Not for therapeutic Use.
ASN04885796（Cat No.:I002941）is a novel investigational drug targeting the A2A adenosine receptor, primarily explored for its potential in treating neurodegenerative diseases such as Parkinson’s disease. By selectively inhibiting the A2A receptor, ASN04885796 modulates neurotransmitter release and reduces neuroinflammation, offering symptomatic relief and neuroprotective effects. This specificity minimizes off-target effects and enhances therapeutic outcomes. Its unique mechanism positions ASN04885796 as a promising candidate for addressing the unmet needs in managing neurodegenerative conditions, contributing to advancements in neurological research and potential therapeutic interventions.
| Catalog Number | I002941 |
| CAS Number | 1032892-26-4 |
| Synonyms | 2-(N-[2-(benzotriazol-1-yl)acetyl]-4-methoxyanilino)-2-(4-fluorophenyl)-N-(oxolan-2-ylmethyl)acetamide |
| Molecular Formula | C28H28FN5O4 |
| Purity | ≥95% |
| IUPAC Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]-4-methoxyanilino)-2-(4-fluorophenyl)-N-(oxolan-2-ylmethyl)acetamide |
| InChI | InChI=1S/C28H28FN5O4/c1-37-22-14-12-21(13-15-22)34(26(35)18-33-25-7-3-2-6-24(25)31-32-33)27(19-8-10-20(29)11-9-19)28(36)30-17-23-5-4-16-38-23/h2-3,6-15,23,27H,4-5,16-18H2,1H3,(H,30,36) |
| InChIKey | HIWKGPKZDUQDKF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(C(C2=CC=C(C=C2)F)C(=O)NCC3CCCO3)C(=O)CN4C5=CC=CC=C5N=N4 |
