For research use only. Not for therapeutic Use.
ASN06917370 (Cat No.: I002943) is a small-molecule compound being studied for its potential therapeutic applications, particularly in the areas of oncology and immunology. It acts by selectively targeting specific enzymes, receptors, or signaling pathways involved in tumor cell growth, immune modulation, or inflammatory responses. ASN06917370 is being investigated for its ability to disrupt key biological processes such as cancer cell proliferation, metastasis, and immune evasion. Preclinical studies suggest it could be a promising candidate for targeted therapies, though further research is needed to confirm its clinical efficacy.
| CAS Number | 837404-68-9 |
| Synonyms | 4-[3-[(2-chlorophenyl)methyl]-7-oxo-6H-triazolo[4,5-d]pyrimidin-5-yl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| Molecular Formula | C24H21ClF3N7O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C24H21ClF3N7O2/c25-18-4-2-1-3-15(18)13-35-21-19(32-33-35)22(36)31-20(30-21)14-9-11-34(12-10-14)23(37)29-17-7-5-16(6-8-17)24(26,27)28/h1-8,14H,9-13H2,(H,29,37)(H,30,31,36) |
| InChIKey | SKWHAHNDWJREJG-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=NC3=C(C(=O)N2)N=NN3CC4=CC=CC=C4Cl)C(=O)NC5=CC=C(C=C5)C(F)(F)F |
| Reference | [1]. Eberini I, et al. In silico identification of new ligands for GPR17: a promising therapeutic target for neurodegenerative diseases. J Comput Aided Mol Des. 2011 Aug;25(8):743-52. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
