For research use only. Not for therapeutic Use.
ASN90(CAT: I040873) is a potent and specific inhibitor of O-GlcNAcase (OGA), an enzyme involved in the hydrolysis of O-linked β-N-acetylglucosamine (O-GlcNAc) modifications on proteins. By inhibiting OGA, ASN90 increases O-GlcNAcylation levels, which play a critical role in regulating cellular functions such as protein stability, signaling, and transcription. ASN90, with an IC50 value of 10.2 nM, is particularly valuable in Neurological Disease Research, as it shows promise in the study of neurodegenerative diseases like tauopathies and α-synucleinopathies. By modulating O-GlcNAcylation, ASN90 may help reduce toxic protein aggregation and offer a potential therapeutic approach for these diseases.
| CAS Number | 1884154-02-2 |
| Synonyms | N-[5-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-1,3,4-thiadiazol-2-yl]acetamide |
| Molecular Formula | C17H21N5O3S |
| Purity | ≥95% |
| IUPAC Name | N-[5-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-1,3,4-thiadiazol-2-yl]acetamide |
| InChI | InChI=1S/C17H21N5O3S/c1-11(13-3-4-14-15(9-13)25-10-24-14)21-5-7-22(8-6-21)17-20-19-16(26-17)18-12(2)23/h3-4,9,11H,5-8,10H2,1-2H3,(H,18,19,23)/t11-/m0/s1 |
| InChIKey | PLUUAFJXXNCXSD-NSHDSACASA-N |
| SMILES | CC(C1=CC2=C(C=C1)OCO2)N3CCN(CC3)C4=NN=C(S4)NC(=O)C |
