For research use only. Not for therapeutic Use.
ASN90 is a specific and orally active O-GlcNAcase (OGA) enzyme inhibitor with IC50 value of 10.2 nM. ASN90 can be used for the research of neurodegenerative diseases, such as tauopathies and α-synucleinopathies[1].
| Catalog Number | I040873 |
| CAS Number | 1884154-02-2 |
| Synonyms | N-[5-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-1,3,4-thiadiazol-2-yl]acetamide |
| Molecular Formula | C17H21N5O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C17H21N5O3S/c1-11(13-3-4-14-15(9-13)25-10-24-14)21-5-7-22(8-6-21)17-20-19-16(26-17)18-12(2)23/h3-4,9,11H,5-8,10H2,1-2H3,(H,18,19,23)/t11-/m0/s1 |
| InChIKey | PLUUAFJXXNCXSD-NSHDSACASA-N |
| SMILES | CC(C1=CC2=C(C=C1)OCO2)N3CCN(CC3)C4=NN=C(S4)NC(=O)C |
| Reference | [1]. Permanne B, et al. O-GlcNAcase Inhibitor ASN90 is a Multimodal Drug Candidate for Tau and α-Synuclein Proteinopathies. ACS Chem Neurosci. 2022 Apr 20;13(8):1296-1314. |
