For research use only. Not for therapeutic Use.
Aspulvinone O(CAT: R066853) is a naturally occurring polyketide compound produced by certain fungal species, particularly those belonging to the genus Aspergillus. It belongs to the class of aspulvinones, which are known for their diverse biological activities, including antimicrobial, antioxidant, and cytotoxic effects. Aspulvinone O is of interest in natural product chemistry and pharmacology due to its potential therapeutic properties, especially in the development of new antimicrobial agents or anticancer therapies. Research on Aspulvinone O often focuses on its biosynthesis, structural elucidation, and the exploration of its bioactivity against various pathogens and cancer cell lines. Its unique chemical structure also makes it a valuable compound for studying fungal secondary metabolites and their potential applications in medicine.
CAS Number | 914071-54-8 |
Synonyms | (5E)-3-[2,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-4-hydroxy-5-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methylidene]furan-2-one |
Molecular Formula | C27H28O6 |
Purity | ≥95% |
IUPAC Name | (5Z)-3-[2,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-4-hydroxy-5-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methylidene]furan-2-one |
InChI | InChI=1S/C27H28O6/c1-15(2)5-8-18-11-17(7-10-21(18)28)12-24-26(31)25(27(32)33-24)20-13-19(9-6-16(3)4)22(29)14-23(20)30/h5-7,10-14,28-31H,8-9H2,1-4H3/b24-12+ |
InChIKey | IAHWCROWFXOMDG-WYMPLXKRSA-N |
SMILES | CC(=CCC1=CC(=C(C=C1O)O)C2=C(C(=CC3=CC(=C(C=C3)O)CC=C(C)C)OC2=O)O)C |