For research use only. Not for therapeutic Use.
AST-1306 TsOH(Cat No.:I000278)is a potent, irreversible inhibitor of the epidermal growth factor receptor (EGFR) and human epidermal growth factor receptor 2 (HER2), both of which are crucial targets in cancer therapy. This compound is typically used in research for its ability to block the signaling pathways that promote tumor growth and survival. The TsOH (p-toluenesulfonic acid) salt form enhances the solubility and stability of AST-1306, making it easier to handle in laboratory settings. It is widely studied for its potential in developing targeted cancer therapies, particularly in cases resistant to traditional EGFR inhibitors.
CAS Number | 1050500-29-2 |
Synonyms | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]prop-2-enamide;4-methylbenzenesulfonic acid |
Molecular Formula | C31H26ClFN4O5S |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
IC50 | 0.5/3 nM (EGFR/Erb2) |
IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]prop-2-enamide;4-methylbenzenesulfonic acid |
InChI | InChI=1S/C24H18ClFN4O2.C7H8O3S/c1-2-23(31)29-17-6-8-21-19(11-17)24(28-14-27-21)30-18-7-9-22(20(25)12-18)32-13-15-4-3-5-16(26)10-15;1-6-2-4-7(5-3-6)11(8,9)10/h2-12,14H,1,13H2,(H,29,31)(H,27,28,30);2-5H,1H3,(H,8,9,10) |
InChIKey | ZMUKJEHWLJBODV-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C=CC(=O)NC1=CC2=C(C=C1)N=CN=C2NC3=CC(=C(C=C3)OCC4=CC(=CC=C4)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |