For research use only. Not for therapeutic Use.
Astragalin (CAT: I003685), also known as kaempferol 3-glucoside, is a flavonoid compound found in various plants, including Astragalus and Morus species. It possesses antioxidant, anti-inflammatory, and anti-cancer properties. Astragalin has been shown to scavenge free radicals, reduce oxidative stress, and inhibit inflammatory mediators, contributing to its potential in preventing chronic diseases. Additionally, it exhibits anticancer effects by inhibiting cell proliferation, inducing apoptosis, and suppressing tumor growth. Astragalin also has potential applications in cardiovascular health, neuroprotection, and diabetes management.
CAS Number | 480-10-4 |
Molecular Formula | C21H20O11 |
Purity | ≥95% |
Target | NF-κB |
Solubility | 10 mM in DMSO |
Storage | 3 years -20℃ powder |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
InChI | 1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
InChIKey | JPUKWEQWGBDDQB-QSOFNFLRSA-N |
SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |