For research use only. Not for therapeutic Use.
Astrophloxine(Cat No.:R011655)is a synthetic compound with potential applications in the field of antimicrobial and anticancer research. It is known for its ability to intercalate into DNA, disrupting the structure and inhibiting essential cellular processes like replication and transcription. This mechanism makes astrophloxine effective against certain bacterial strains and cancer cells. Its antimicrobial properties are being investigated for use in treating infections, while its anticancer potential is being explored through its ability to induce apoptosis in tumor cells. Ongoing research aims to evaluate its safety, efficacy, and broader therapeutic applications in clinical settings.
CAS Number | 14696-39-0 |
Synonyms | (2Z)-1-ethyl-2-[(E)-3-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole;iodide |
Molecular Formula | C27H33IN2 |
Purity | ≥95% |
IUPAC Name | 1-ethyl-2-[3-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole;iodide |
InChI | InChI=1S/C27H33N2.HI/c1-7-28-22-16-11-9-14-20(22)26(3,4)24(28)18-13-19-25-27(5,6)21-15-10-12-17-23(21)29(25)8-2;/h9-19H,7-8H2,1-6H3;1H/q+1;/p-1 |
InChIKey | LGRNGKUSEZTBMB-UHFFFAOYSA-M |
SMILES | CCN1C2=CC=CC=C2C(C1=CC=CC3=[N+](C4=CC=CC=C4C3(C)C)CC)(C)C.[I-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |