For research use only. Not for therapeutic Use.
Atabecestat is a small-molecule beta-secretase 1 (BACE1) inhibitor that was developed as a potential treatment for Alzheimer’s disease. BACE1 is an enzyme involved in the production of beta-amyloid peptides, which accumulate in the brains of Alzheimer’s patients and are believed to play a key role in the disease’s progression. By inhibiting BACE1, Atabecestat aimed to reduce the production of beta-amyloid and slow or prevent the cognitive decline associated with Alzheimer’s. However, clinical development of Atabecestat was discontinued due to safety concerns, particularly liver toxicity observed in trial participants.
| Catalog Number | I011876 |
| CAS Number | 1200493-78-2 |
| Synonyms | N-[3-[(4S)-2-Amino-4-methyl-4H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-cyano-2-pyridinecarboxamide |
| Molecular Formula | C18H14FN5OS |
| Purity | ≥95% |
| Target | beta-secretase |
| Storage | Store at 0-8 °C |
| IC50 | 0.010 μM |
| IUPAC Name | N-[3-[(4S)-2-amino-4-methyl-1,3-thiazin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| InChI | InChI=1S/C18H14FN5OS/c1-18(6-7-26-17(21)24-18)13-8-12(3-4-14(13)19)23-16(25)15-5-2-11(9-20)10-22-15/h2-8,10H,1H3,(H2,21,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | VLLFGVHGKLDDLW-SFHVURJKSA-N |
| SMILES | CC1(C=CSC(=N1)N)C2=C(C=CC(=C2)NC(=O)C3=NC=C(C=C3)C#N)F |
