For research use only. Not for therapeutic Use.
ATB 346(Cat No.:I000874) is a novel derivative of naproxen, a nonsteroidal anti-inflammatory drug (NSAID). What sets ATB 346 apart is its ability to release hydrogen sulfide, which confers additional pharmacological benefits. ATB 346 retains the COX (cyclooxygenase) inhibitory activity of naproxen, providing anti-inflammatory effects. Moreover, it exhibits reduced toxicity compared to traditional NSAIDs. In addition to its anti-inflammatory properties, ATB 346 has shown the ability to induce apoptosis (programmed cell death) specifically in human melanoma cells, suggesting its potential as an anti-cancer agent.
CAS Number | 1226895-20-0 |
Synonyms | 4-carbamothioylphenyl 2-(6-methoxynaphthalen-2-yl)propanoate |
Molecular Formula | C21H19NO3S |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 51.6 mg/mL |
Storage | Store at -20°C |
IUPAC Name | (4-carbamothioylphenyl) 2-(6-methoxynaphthalen-2-yl)propanoate |
InChI | InChI=1S/C21H19NO3S/c1-13(21(23)25-18-8-5-14(6-9-18)20(22)26)15-3-4-17-12-19(24-2)10-7-16(17)11-15/h3-13H,1-2H3,(H2,22,26) |
InChIKey | YCNMAPLPQYQJFC-UHFFFAOYSA-N |
SMILES | CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)OC3=CC=C(C=C3)C(=S)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |