For research use only. Not for therapeutic Use.
ATC0175（Cat No.:I010748）is an investigational compound being studied for its potential therapeutic applications, particularly in the treatment of cancer. It is a small molecule designed to target specific signaling pathways involved in tumor growth, survival, and metastasis. ATC0175 works by inhibiting key proteins or enzymes that promote cancer cell proliferation and resistance to cell death. Ongoing research aims to evaluate its efficacy, safety, and potential applications in various cancer types, including solid tumors and hematological malignancies. If successful, ATC0175 could provide a novel treatment option for patients with advanced or resistant cancers.
| CAS Number | 510733-97-8 |
| Synonyms | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3,4-difluorobenzamide;hydrochloride |
| Molecular Formula | C23H26ClF2N5O |
| Purity | ≥95% |
| IUPAC Name | N-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-3,4-difluorobenzamide;hydrochloride |
| InChI | InChI=1S/C23H25F2N5O.ClH/c1-30(2)21-17-5-3-4-6-20(17)28-23(29-21)27-16-10-8-15(9-11-16)26-22(31)14-7-12-18(24)19(25)13-14;/h3-7,12-13,15-16H,8-11H2,1-2H3,(H,26,31)(H,27,28,29);1H |
| InChIKey | HUUPKFUYSQNNLO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC2=CC=CC=C21)NC3CCC(CC3)NC(=O)C4=CC(=C(C=C4)F)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
