For research use only. Not for therapeutic Use.
Atenolol-d7 (CAS 1202864-50-3) is a high-purity deuterated compound used in advanced pharmaceutical research. This isotopically labeled version of Atenolol is essential for studies involving beta-blockers, cardiovascular therapeutics, pharmacokinetics, and metabolic pathways. Featuring seven deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for cardiovascular research and drug development, Atenolol-d7 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000034 |
| CAS Number | 1202864-50-3 |
| Molecular Formula | C14H15D7N2O3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | 2-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide |
| InChI | InChI=1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18)/i1D3,2D3,10D |
| InChIKey | METKIMKYRPQLGS-SVMCCORHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CC(=O)N)O |
