For research use only. Not for therapeutic Use.
Atg4B-IN-2(Cat No.:I043879)is a selective small molecule inhibitor designed to target Atg4B, a key enzyme involved in autophagy, the cellular process responsible for degrading and recycling damaged proteins and organelles. Atg4B plays a crucial role in the maturation of autophagosomes, and inhibiting it with Atg4B-IN-2 disrupts the autophagic process. This compound has shown promise in preclinical studies for treating cancers, neurodegenerative diseases, and infections, where altered autophagy contributes to disease progression. By selectively targeting Atg4B, Atg4B-IN-2 offers a potential therapeutic approach to modulating autophagy for disease treatment.
CAS Number | 2765008-88-4 |
Synonyms | (E)-4-oxo-4-(4-undecylphenyl)but-2-enoic acid |
Molecular Formula | C21H30O3 |
Purity | ≥95% |
IUPAC Name | (E)-4-oxo-4-(4-undecylphenyl)but-2-enoic acid |
InChI | InChI=1S/C21H30O3/c1-2-3-4-5-6-7-8-9-10-11-18-12-14-19(15-13-18)20(22)16-17-21(23)24/h12-17H,2-11H2,1H3,(H,23,24)/b17-16+ |
InChIKey | XEPLKXYXNJMMCI-WUKNDPDISA-N |
SMILES | CCCCCCCCCCCC1=CC=C(C=C1)C(=O)/C=C/C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |