For research use only. Not for therapeutic Use.
ATG7-IN-3（Cat No.:I043688）is a selective small molecule inhibitor that targets ATG7, a critical protein involved in the process of autophagy, which helps cells maintain homeostasis by degrading damaged components. By inhibiting ATG7, ATG7-IN-3 disrupts autophagy, potentially slowing the growth of cancer cells and affecting the progression of neurodegenerative diseases where dysfunctional autophagy plays a role. Preclinical studies suggest that ATG7-IN-3 could enhance the effectiveness of chemotherapy by impairing cancer cells’ ability to clear toxic proteins. It also holds promise for treating conditions like Alzheimer’s and Parkinson’s diseases where autophagic dysfunction is involved.
| CAS Number | 2226229-76-9 |
| Synonyms | [(2R,3S,5R)-5-(4-amino-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl sulfamate |
| Molecular Formula | C11H16N6O5S2 |
| Purity | ≥95% |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl sulfamate |
| InChI | InChI=1S/C11H16N6O5S2/c1-23-11-8-9(12)14-4-15-10(8)17(16-11)7-2-5(18)6(22-7)3-21-24(13,19)20/h4-7,18H,2-3H2,1H3,(H2,12,14,15)(H2,13,19,20)/t5-,6+,7+/m0/s1 |
| InChIKey | PEIYQDSNKNROMJ-RRKCRQDMSA-N |
| SMILES | CSC1=NN(C2=NC=NC(=C21)N)[C@H]3C[C@@H]([C@H](O3)COS(=O)(=O)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
