For research use only. Not for therapeutic Use.
Atipamezole（Cat No.:I000237）is a potent alpha-2 adrenergic receptor antagonist primarily used in veterinary medicine to reverse the sedative effects of alpha-2 agonists like medetomidine and dexmedetomidine. By competitively inhibiting these receptors, atipamezole rapidly restores normal physiological functions, facilitating quicker recovery from sedation and anesthesia in animals. Its high selectivity and rapid onset of action make it an essential tool for managing sedation in clinical and surgical settings. Additionally, atipamezole is being studied for potential applications in human medicine, including treatments for depression and neuroprotection.
| Catalog Number | I000237 |
| CAS Number | 104054-27-5 |
| Synonyms | 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole |
| Molecular Formula | C14H16N2 |
| Purity | ≥95% |
| IUPAC Name | 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole |
| InChI | InChI=1S/C14H16N2/c1-2-14(13-9-15-10-16-13)7-11-5-3-4-6-12(11)8-14/h3-6,9-10H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | HSWPZIDYAHLZDD-UHFFFAOYSA-N |
| SMILES | CCC1(CC2=CC=CC=C2C1)C3=CN=CN3 |
