For research use only. Not for therapeutic Use.
Adenosine triphosphate (ATP)(Cat No.:A000943)is a nucleotide that serves as the primary energy carrier in living organisms. Composed of adenine, ribose, and three phosphate groups, ATP stores and transfers energy within cells. When the terminal phosphate bond is hydrolyzed, ATP releases energy that powers various biological processes, including muscle contraction, neurotransmission, and biosynthesis. Additionally, ATP plays crucial roles in signal transduction and cellular metabolism. It is often referred to as the “molecular unit of currency” of intracellular energy transfer, highlighting its essential function in sustaining life.
CAS Number | 987-65-5 |
Synonyms | Adenosine-Triphosphate |
Molecular Formula | C10H14N5O13P3 • 2Na |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | 3 years -20C powder |
IUPAC Name | disodium;[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
InChI | InChI=1S/C10H16N5O13P3.2Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20);;/q;2*+1/p-2/t4-,6-,7-,10-;;/m1../s1 |
InChIKey | TTWYZDPBDWHJOR-IDIVVRGQSA-L |
SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)([O-])OP(=O)(O)[O-])O)O)N.[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |