For research use only. Not for therapeutic Use.
ATR Inhibitor 1（Cat No.:I019110）is a potent and selective inhibitor of the Ataxia Telangiectasia and Rad3-related (ATR) protein kinase, which plays a critical role in the DNA damage response, particularly in the repair of single-strand DNA breaks. By inhibiting ATR, this compound prevents the activation of the ATR-mediated checkpoint signaling pathway, leading to increased sensitivity of cancer cells to DNA-damaging agents and impaired DNA repair. ATR Inhibitor 1 is valuable in cancer research for exploring therapeutic strategies that exploit DNA repair deficiencies in tumors, offering potential in targeted cancer treatments.
| Catalog Number | I019110 |
| CAS Number | 1613200-51-3 |
| Molecular Formula | C₁₆H₁₂F₂N₈O |
| Purity | ≥95% |
| IUPAC Name | 2-amino-6-fluoro-N-[5-fluoro-4-(3-methylimidazol-4-yl)pyridin-3-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| InChI | InChI=1S/C16H12F2N8O/c1-25-7-21-5-11(25)12-9(18)3-20-4-10(12)23-16(27)13-14(19)24-26-6-8(17)2-22-15(13)26/h2-7H,1H3,(H2,19,24)(H,23,27) |
| InChIKey | RBQPCTBFIPVIJN-UHFFFAOYSA-N |
| SMILES | CN1C=NC=C1C2=C(C=NC=C2NC(=O)C3=C4N=CC(=CN4N=C3N)F)F |
| Reference | [1]. Nadia AHMAD, et al. Radiolabelled derivatives of a 2-amino-6-fluoro-n-[5-fluoro-pyridin-3-yl]- pyrazolo[1,5-a]pyrimidin-3-carboxamide compound useful as atr kinase inhibitor, the preparation of said compound and different solid forms thereof. WO2015187451A1 |
