For research use only. Not for therapeutic Use.
Atractylenolide III (CAT: I004719) is a natural compound derived from the medicinal herb Atractylodes macrocephala. It belongs to the class of sesquiterpene lactones and exhibits various pharmacological activities. Atractylenolide III has been found to possess anti-inflammatory, immunomodulatory, and anti-tumor properties. It inhibits the production of inflammatory mediators, such as nitric oxide and pro-inflammatory cytokines, and modulates immune cell function. Additionally, it has shown potential in inhibiting the growth and proliferation of cancer cells. Atractylenolide III has been studied for its therapeutic potential in various inflammatory disorders and cancers, highlighting its importance as a natural product with promising pharmacological properties.
CAS Number | 73030-71-4 |
Molecular Formula | C15H20O3 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | (4aS,8aR,9aS)-9a-hydroxy-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran-2-one |
InChI | 1S/C15H20O3/c1-9-5-4-6-14(3)8-15(17)12(7-11(9)14)10(2)13(16)18-15/h11,17H,1,4-8H2,2-3H3/t11-,14+,15-/m0/s1 |
InChIKey | FBMORZZOJSDNRQ-GLQYFDAESA-N |
SMILES | CC1=C2C[C@H]3C(=C)CCC[C@@]3(C[C@@]2(OC1=O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |