For research use only. Not for therapeutic Use.
Atractyloside A（Cat No.:I001043） is a compound known for its diverse pharmacological activities. It possesses antihypertensive properties, helping to lower high blood pressure. Additionally, it exhibits hypoglycemic effects, aiding in the reduction of blood sugar levels. Moreover, Atractyloside A has been investigated for its potential antitumor properties, showing promise as a candidate for cancer treatment. The multifaceted nature of Atractyloside A makes it a compound of interest for researchers exploring therapeutic interventions for hypertension, diabetes, and cancer.
| Catalog Number | I001043 |
| CAS Number | 126054-77-1 |
| Molecular Formula | C21H36O10 |
| Purity | ≥95% |
| Solubility | DMSO: 30 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | (3S,3aR,5R,8R,8aS)-3,8-dihydroxy-8-(hydroxymethyl)-3-methyl-5-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-3a,4,5,6,7,8a-hexahydro-1H-azulen-2-one |
| InChI | InChI=1S/C21H36O10/c1-19(2,31-18-17(27)16(26)15(25)13(8-22)30-18)10-4-5-21(29,9-23)12-7-14(24)20(3,28)11(12)6-10/h10-13,15-18,22-23,25-29H,4-9H2,1-3H3/t10-,11-,12+,13-,15-,16+,17-,18+,20+,21+/m1/s1 |
| InChIKey | QNBLVYVBWDIWDM-BSLJOXIBSA-N |
| SMILES | CC1(C2CC(CCC(C2CC1=O)(CO)O)C(C)(C)OC3C(C(C(C(O3)CO)O)O)O)O |
| Reference | <p style=/line-height:25px/> |
