For research use only. Not for therapeutic Use.
Atranorin(cas 479-20-9) is a derivative compound of Chloratranorin , which are metabolites of Evernia prunastri and functions as antioxidant, antimicrobial and potential anticancer agents.
| Catalog Number | R035073 |
| CAS Number | 479-20-9 |
| Synonyms | Atranorine; NSC 249980; NSC 685591; NSC 87512; Parmelin; Parmelin Acid; Usnarin; Usnarin Acid |
| Molecular Formula | C19H18O8 |
| Purity | 98% |
| Target | MAPK/ERK Pathway |
| Appearance | White solid |
| Storage | Desiccate at -20C |
| IUPAC Name | (3-hydroxy-4-methoxycarbonyl-2,5-dimethylphenyl) 3-formyl-2,4-dihydroxy-6-methylbenzoate |
| InChI | InChI=1S/C19H18O8/c1-8-5-12(21)11(7-20)17(23)15(8)19(25)27-13-6-9(2)14(18(24)26-4)16(22)10(13)3/h5-7,21-23H,1-4H3 |
| InChIKey | YLOYKYXNDHOHHT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC2=C(C(=C(C(=C2)C)C(=O)OC)O)C)O)C=O)O |
