For research use only. Not for therapeutic Use.
Atrazine-d5(Cat No.:R009422) is a high-purity deuterated compound, indispensable for advanced agricultural and environmental research. This isotopically labeled version of Atrazine, featuring five deuterium atoms, is crucial for studies involving herbicide activity, environmental fate, and residue analysis. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of soil and water contamination assessments. With improved stability and consistency, Atrazine-d5 integrates seamlessly into various experimental setups, providing a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 163165-75-1 |
Synonyms | 6-Chloro-N-(ethyl-d5)-N’-(1-methylethyl)-1,3,5-triazine-2,4-diamine;?2-Chloro-4-(ethylamino-d5)-6-(2-propylamino)-s-triazine; AAtrex-d5; Gesamprim-d5; Gesaprim-d5; Gesaprim-d5; |
Molecular Formula | C8H14ClN5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-chloro-4-N-(1,1,2,2,2-pentadeuterioethyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
InChI | InChI=1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14)/i1D3,4D2 |
InChIKey | MXWJVTOOROXGIU-SGEUAGPISA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])NC1=NC(=NC(=N1)Cl)NC(C)C |