For research use only. Not for therapeutic Use.
Atropine-d5 is a high-purity deuterated compound used in pharmaceutical and biochemical research. This isotopically labeled version of Atropine is crucial for studies involving drug metabolism, pharmacokinetics, and toxicology. Featuring five deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and reproducibility, making it suitable for various experimental setups. Ideal for pharmacological and toxicological research, Atropine-d5 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000100 |
| Molecular Formula | C17H18D5NO3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)propanoate |
| InChI | InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15?,16?/i2D,3D,4D,5D,6D |
| InChIKey | RKUNBYITZUJHSG-FTPSATHDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CO)C(=O)OC2C[C@H]3CC[C@@H](C2)N3C)[2H])[2H] |
