For research use only. Not for therapeutic Use.
AUDA(CAT: I011757) is a small molecule that inhibits the activity of the enzyme soluble epoxide hydrolase (sEH). sEH is involved in the metabolism of epoxyeicosatrienoic acids (EETs), which are signaling molecules that play a role in regulating blood pressure and inflammation. By inhibiting sEH, AUDA increases the levels of EETs, leading to vasodilation and decreased inflammation. This property of AUDA has led to its use in research and the development of pharmaceuticals for the treatment of hypertension, inflammation, and other related diseases.
Catalog Number | I011757 |
CAS Number | 479413-70-2 |
Synonyms | 12-(3-((3s,5s,7s)-adamantan-1-yl)ureido)dodecanoic acid |
Molecular Formula | C23H40N2O3 |
Purity | ≥95% |
Target | Epoxide Hydrolase |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 12-(1-adamantylcarbamoylamino)dodecanoic acid |
InChI | InChI=1S/C23H40N2O3/c26-21(27)10-8-6-4-2-1-3-5-7-9-11-24-22(28)25-23-15-18-12-19(16-23)14-20(13-18)17-23/h18-20H,1-17H2,(H,26,27)(H2,24,25,28) |
InChIKey | XLGSEOAVLVTJDH-UHFFFAOYSA-N |
SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)NCCCCCCCCCCCC(=O)O |