For research use only. Not for therapeutic Use.
Aureusidin synthase, which plays a key role in the yellow coloration of snapdragon flowers, is a homolog of plant polyphenol oxidase (PPO).
| Catalog Number | R048637 |
| CAS Number | 38216-54-5 |
| Synonyms | (2Z)-2-[(3,4-dihydroxyphenyl)methylene]-4,6-dihydroxy-3(2H)-benzofuranone; Cernuin; |
| Molecular Formula | C15H10O6 |
| Purity | 95% |
| Storage | Store at +4C |
| IUPAC Name | (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
| InChI | InChI=1S/C15H10O6/c16-8-5-11(19)14-12(6-8)21-13(15(14)20)4-7-1-2-9(17)10(18)3-7/h1-6,16-19H/b13-4- |
| InChIKey | WBEFUVAYFSOUEA-PQMHYQBVSA-N |
| SMILES | C1=CC(=C(C=C1C=C2C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
