For research use only. Not for therapeutic Use.
Auristatin E（Cat No.:I002043）is a synthetic peptide derived from the natural product dolastatin 10, known for its potent antitumor properties. It functions as a microtubule-disrupting agent, inhibiting cell division and promoting apoptosis in cancer cells. As part of antibody-drug conjugates (ADCs), auristatin E is linked to monoclonal antibodies, allowing targeted delivery to tumors while minimizing systemic toxicity. This targeted approach enhances its therapeutic efficacy against various cancers, including lymphoma and solid tumors. Ongoing research aims to optimize its application in cancer therapy, focusing on improving delivery mechanisms and reducing side effects.
| Catalog Number | I002043 |
| CAS Number | 160800-57-7 |
| Molecular Formula | C40H69N5O7 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-N-[(3R,4S,5S)-1-[(2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidin-1-yl]-3-methoxy-5-methyl-1-oxoheptan-4-yl]-N,3-dimethylbutanamide |
| InChI | InChI=1S/C40H69N5O7/c1-14-26(6)35(44(11)40(50)33(24(2)3)42-39(49)34(25(4)5)43(9)10)31(51-12)23-32(46)45-22-18-21-30(45)37(52-13)27(7)38(48)41-28(8)36(47)29-19-16-15-17-20-29/h15-17,19-20,24-28,30-31,33-37,47H,14,18,21-23H2,1-13H3,(H,41,48)(H,42,49)/t26-,27+,28+,30-,31+,33-,34-,35-,36+,37+/m0/s1 |
| InChIKey | WOWDZACBATWTAU-FEFUEGSOSA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@@H](C)C(=O)N[C@H](C)[C@H](C2=CC=CC=C2)O)OC)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)N(C)C |
| Reference | <p style=/line-height:25px/> |
