For research use only. Not for therapeutic Use.
Auristatin F（Cat No.:I002128）is a potent antitumor agent derived from the marine sponge Haliclona. As a member of the auristatin family, it exhibits strong cytotoxicity by disrupting microtubule dynamics, which leads to cell cycle arrest and apoptosis in rapidly dividing cancer cells. Auristatin F is often studied for its potential in targeted cancer therapies, particularly when conjugated to antibody-drug conjugates (ADCs) to enhance selective delivery to tumor tissues. Ongoing research focuses on optimizing its efficacy and safety profile, aiming to position Auristatin F as a valuable therapeutic option in oncology.
| Catalog Number | I002128 |
| CAS Number | 163768-50-1 |
| Molecular Formula | C40H67N5O8 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Solubility | DMSO: ≥ 56 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-2-[[(2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanoyl]amino]-3-phenylpropanoic acid |
| InChI | InChI=1S/C40H67N5O8/c1-13-26(6)35(44(10)39(49)33(24(2)3)42-38(48)34(25(4)5)43(8)9)31(52-11)23-32(46)45-21-17-20-30(45)36(53-12)27(7)37(47)41-29(40(50)51)22-28-18-15-14-16-19-28/h14-16,18-19,24-27,29-31,33-36H,13,17,20-23H2,1-12H3,(H,41,47)(H,42,48)(H,50,51)/t26-,27+,29-,30-,31+,33-,34-,35-,36+/m0/s1 |
| InChIKey | LGNCNVVZCUVPOT-FUVGGWJZSA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@@H](C)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)OC)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)N(C)C |
| Reference | <p style=/line-height:25px/> |
