For research use only, not for therapeutic use.
Aurora Kinase Inhibitor II（Cat No.:R065595）is a potent, selective inhibitor targeting Aurora kinases, crucial enzymes in cell cycle regulation and mitosis. By inhibiting Aurora A and B kinases, it disrupts mitotic spindle formation, leading to cell cycle arrest and apoptosis, particularly in rapidly dividing cancer cells. This inhibitor has shown promise in preclinical studies for its potential in treating various cancers, including leukemia, breast, and colorectal cancers. Its selectivity and efficacy make it a valuable tool in cancer research, enabling better understanding of cell division and therapeutic approaches for malignancies.
| Catalog Number | R065595 |
| CAS Number | 331770-21-9 |
| Synonyms | 4-(4ʹ-Benzamidoanilino)-6,7-dimethoxyquinazoline |
| Molecular Formula | C23H20N4O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]benzamide |
| InChI | InChI=1S/C23H20N4O3/c1-29-20-12-18-19(13-21(20)30-2)24-14-25-22(18)26-16-8-10-17(11-9-16)27-23(28)15-6-4-3-5-7-15/h3-14H,1-2H3,(H,27,28)(H,24,25,26) |
| InChIKey | IMYVCWQAHSYYOO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)NC(=O)C4=CC=CC=C4)OC |
| Reference | 1.Heron, N.M.,Anderson, M.,Blowers, D.P., et al. SAR and inhibitor complex structure determination of a novel class of potent and specific Aurora kinase inhibitors. Bioorganic & Medicinal Chemistry Letters 16(5), 1320-1323 (2006). |
