For research use only. Not for therapeutic Use.
Autogramin-2 (Cat No.:I018672) is a bioactive peptide derived from the marine bacterium Streptomyces species, known for its antimicrobial properties. It is primarily studied for its antibiotic activity, particularly against Gram-positive bacteria and fungi. Autogramin-2 inhibits protein synthesis by interacting with the bacterial ribosome, making it a potential candidate for the development of new antibiotics. Research is ongoing to explore its mechanism of action, efficacy, and potential therapeutic applications, particularly in combating antibiotic-resistant infections.
CAS Number | 2375541-45-8 |
Molecular Formula | C₂₁H₂₇N₃O₄S |
Purity | ≥95% |
Target | Autophagy |
Storage | -20°C |
IUPAC Name | tert-butyl 2-[(4-propan-2-yloxybenzoyl)amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
InChI | InChI=1S/C21H27N3O4S/c1-13(2)27-15-8-6-14(7-9-15)18(25)23-19-22-16-10-11-24(12-17(16)29-19)20(26)28-21(3,4)5/h6-9,13H,10-12H2,1-5H3,(H,22,23,25) |
InChIKey | PNSFNXURLSDVRV-UHFFFAOYSA-N |
SMILES | CC(C)OC1=CC=C(C=C1)C(=O)NC2=NC3=C(S2)CN(CC3)C(=O)OC(C)(C)C |