For research use only. Not for therapeutic Use.
Autophagy inducer 3(Cat No.:I043692)is a small molecule compound designed to stimulate the autophagy process, a critical cellular mechanism for maintaining homeostasis by degrading and recycling damaged cellular components. By activating autophagy, Autophagy inducer 3 helps cells remove toxic proteins, damaged organelles, and other dysfunctional components, which is beneficial in various diseases, including neurodegenerative disorders, cancer, and infections. In preclinical studies, this compound has shown promise in promoting cellular health, enhancing drug efficacy, and potentially slowing disease progression in conditions where impaired autophagy contributes to pathogenesis.
CAS Number | 2691054-63-2 |
Synonyms | (2S,3S)-2-amino-1-(4-methoxyphenyl)heptadecan-3-ol |
Molecular Formula | C24H43NO2 |
Purity | ≥95% |
IUPAC Name | (2S,3S)-2-amino-1-(4-methoxyphenyl)heptadecan-3-ol |
InChI | InChI=1S/C24H43NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-24(26)23(25)20-21-16-18-22(27-2)19-17-21/h16-19,23-24,26H,3-15,20,25H2,1-2H3/t23-,24-/m0/s1 |
InChIKey | HMKPXKFKBCPUEK-ZEQRLZLVSA-N |
SMILES | CCCCCCCCCCCCCC[C@@H]([C@H](CC1=CC=C(C=C1)OC)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |