For research use only. Not for therapeutic Use.
AV167 is a hClpP inhibitor.
| Catalog Number | I022695 |
| Synonyms | AV167; AV 167; AV-167; |
| Molecular Formula | C22H14N2O4 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-(1,3,4-oxadiazol-2-yl)phenyl 2-(naphtho[2,1-b]furan-1-yl)acetate |
| InChI | InChI=1S/C22H14N2O4/c25-20(28-17-8-5-15(6-9-17)22-24-23-13-27-22)11-16-12-26-19-10-7-14-3-1-2-4-18(14)21(16)19/h1-10,12-13H,11H2 |
| InChIKey | UPFIGKNEXDPWKJ-UHFFFAOYSA-N |
| SMILES | O=C(OC1=CC=C(C2=NN=CO2)C=C1)CC3=COC4=C3C5=C(C=CC=C5)C=C4 |
