For research use only. Not for therapeutic Use.
Avibactam Free Acid（Cat No.:I000699）is a non-β-lactam β-lactamase inhibitor used in combination with β-lactam antibiotics to combat antibiotic-resistant bacterial infections. It works by inhibiting the action of β-lactamase enzymes produced by certain bacteria, which would otherwise degrade β-lactam antibiotics and render them ineffective. Avibactam enhances the efficacy of antibiotics like ceftazidime against multi-drug-resistant strains, including Gram-negative bacteria. Its role in treating severe infections, such as complicated intra-abdominal and urinary tract infections, underscores its importance in modern medicine for addressing antibiotic resistance and improving patient outcomes.
| Catalog Number | I000699 |
| CAS Number | 1192500-31-4 |
| Synonyms | [(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| Molecular Formula | C7H11N3O6S |
| Purity | ≥95% |
| IUPAC Name | [(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| InChI | InChI=1S/C7H11N3O6S/c8-6(11)5-2-1-4-3-9(5)7(12)10(4)16-17(13,14)15/h4-5H,1-3H2,(H2,8,11)(H,13,14,15)/t4-,5+/m1/s1 |
| InChIKey | NDCUAPJVLWFHHB-UHNVWZDZSA-N |
| SMILES | C1CC(N2CC1N(C2=O)OS(=O)(=O)O)C(=O)N |
