For research use only. Not for therapeutic Use.
Avibactam Sodium（Cat No.:I003307） is a high-purity β-lactamase inhibitor vital for advanced pharmaceutical research. It enhances the efficacy of β-lactam antibiotics by protecting them from enzymatic degradation, making it a key component in combating antibiotic-resistant bacterial infections. This compound is crucial for studies focused on antimicrobial resistance and drug development. Its stability and high purity ensure precise and reliable analytical results, supporting robust experimental setups. Ideal for research in bacterial resistance mechanisms and novel antibiotic therapies, Avibactam Sodium is indispensable in the fight against resistant pathogens.
| Catalog Number | I003307 |
| CAS Number | 1192491-61-4 |
| Synonyms | sodium;[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| Molecular Formula | C7H10N3NaO6S |
| Purity | ≥95% |
| IUPAC Name | sodium;[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| InChI | InChI=1S/C7H11N3O6S.Na/c8-6(11)5-2-1-4-3-9(5)7(12)10(4)16-17(13,14)15;/h4-5H,1-3H2,(H2,8,11)(H,13,14,15);/q;+1/p-1/t4-,5+;/m1./s1 |
| InChIKey | RTCIKUMODPANKX-JBUOLDKXSA-M |
| SMILES | C1CC(N2CC1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+] |
