For research use only. Not for therapeutic Use.
Avicularin (Cat.No:R029728) is a natural flavonoid glycoside found in various plant sources, such as plants of the Geraniaceae family. It exhibits antioxidant, anti-inflammatory, and potential anticancer properties. Avicularin has drawn interest for its role in traditional medicine and as a compound with potential therapeutic applications in various health conditions.
CAS Number | 572-30-5 |
Molecular Formula | C20H18O11 |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | 3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
InChI | InChI=1S/C20H18O11/c21-6-13-15(26)17(28)20(30-13)31-19-16(27)14-11(25)4-8(22)5-12(14)29-18(19)7-1-2-9(23)10(24)3-7/h1-5,13,15,17,20-26,28H,6H2/t13-,15-,17+,20-/m0/s1 |
InChIKey | BDCDNTVZSILEOY-UXYNSRGZSA-N |
SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(O4)CO)O)O)O)O |