For research use only. Not for therapeutic Use.
AX-024 HCl（Cat No.:I005045） is a compound that can effectively block the interaction between CD3ε PRS and SH3.1(Nck). This inhibition has important implications in modulating immune responses. AX-024 HCl also demonstrates the ability to inhibit the production of various cytokines, including IL-6, TNF-α, IFN-γ, IL-10, and IL-17A. By targeting these cytokines, AX-024 HCl may have potential therapeutic applications in diseases associated with dysregulated immune responses.
| Catalog Number | I005045 |
| CAS Number | 1704801-24-0 |
| Synonyms | AX-024; AX 024; AX024 HCl; AX-024 hydrochloride;1-((4-(4-Fluorophenyl)-6-methoxy-2H-chromen-3-yl)methyl)pyrrolidine hydrochloride |
| Molecular Formula | C21H23ClFNO2 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | -20° |
| IUPAC Name | 1-[[4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methyl]pyrrolidine;hydrochloride |
| InChI | InChI=1S/C21H22FNO2.ClH/c1-24-18-8-9-20-19(12-18)21(15-4-6-17(22)7-5-15)16(14-25-20)13-23-10-2-3-11-23;/h4-9,12H,2-3,10-11,13-14H2,1H3;1H |
| InChIKey | DGBCIMPGYRVTPD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC(=C2C3=CC=C(C=C3)F)CN4CCCC4.Cl |
| Reference | </br>1: Borroto A, Reyes-Garau D, Jiménez MA, Carrasco E, Moreno B, Martínez-Pasamar</br> S, Cortés JR, Perona A, Abia D, Blanco S, Fuentes M, Arellano I, Lobo J,</br> Heidarieh H, Rueda J, Esteve P, Cibrián D, Martinez-Riaño A, Mendoza P, Prieto C,</br> Calleja E, Oeste CL, Orfao A, Fresno M, Sánchez-Madrid F, Alcamí A, Bovolenta P, </br> Martín P, Villoslada P, Morreale A, Messeguer A, Alarcon B. First-in-class</br> inhibitor of the T cell receptor for the treatment of autoimmune diseases. Sci</br> Transl Med. 2016 Dec 21;8(370):370ra184. doi: 10.1126/scitranslmed.aaf2140.</br> PubMed PMID: 28003549.</br> </br> |
