For research use only. Not for therapeutic Use.
AX20017（Cat No.:I013742）is a small molecule inhibitor that specifically targets protein kinase G (PknG) and has an inhibitory concentration (IC50) of 0.39 μM. PknG is a protein kinase enzyme found in certain bacteria, including Mycobacterium tuberculosis, the causative agent of tuberculosis. By inhibiting PknG, AX20017 interferes with the signaling pathways and biological functions regulated by this kinase. This inhibition has the potential to impair the survival and virulence of the bacteria, making AX20017 a promising candidate for the development of novel anti-tuberculosis therapies.
| Catalog Number | I013742 |
| CAS Number | 329221-38-7 |
| Molecular Formula | C₁₃H₁₆N₂O₂S |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO: ≥ 32 mg/mL |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| InChI | InChI=1S/C13H16N2O2S/c14-11(16)10-8-3-1-2-4-9(8)18-13(10)15-12(17)7-5-6-7/h7H,1-6H2,(H2,14,16)(H,15,17) |
| InChIKey | VATFNEMGBRWLHI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3CC3)C(=O)N |
| Reference | [1]. Walburger A, et al. Protein kinase G from pathogenic mycobacteria promotes survival within macrophages. Science. 2004 Jun 18;304(5678):1800-4.<br>[2]. Santhi N, et al. Insights from the molecular docking of withanolide derivatives to the target protein PknG from Mycobacterium tuberculosis. Bioinformation. 2011;7(1):1-4.<br>[3]. Scherr N, et al. Structural basis for the specific inhibition of protein kinase G, a virulence factor of Mycobacterium tuberculosis. Proc Natl Acad Sci U S A. 2007 Jul 17;104(29):12151-6. |
