For research use only. Not for therapeutic Use.
AZ 12216052（Cat No.:I003365）is an investigational small molecule compound being studied for its potential therapeutic applications, particularly in the field of oncology. It is designed to target specific proteins or signaling pathways involved in tumor growth, survival, and metastasis. AZ 12216052 works by inhibiting key molecular targets that contribute to cancer cell proliferation and resistance to treatment. Ongoing research aims to evaluate its efficacy, safety, and potential clinical benefits in various cancer types, including solid tumors. If successful, AZ 12216052 could offer a novel treatment option for patients with advanced or drug-resistant cancers.
| CAS Number | 1290628-31-7 |
| Synonyms | 2-[(4-bromophenyl)methylsulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
| Molecular Formula | C19H22BrNOS |
| Purity | ≥95% |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
| InChI | InChI=1S/C19H22BrNOS/c1-3-14(2)16-6-10-18(11-7-16)21-19(22)13-23-12-15-4-8-17(20)9-5-15/h4-11,14H,3,12-13H2,1-2H3,(H,21,22) |
| InChIKey | QKUYZJOTWYRWNF-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC=C(C=C1)NC(=O)CSCC2=CC=C(C=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
