For research use only. Not for therapeutic Use.
AZ3146(CAT: I000469) is a potent and selective inhibitor of monopolar spindle 1 (Mps1) kinase, a critical regulator of the spindle assembly checkpoint (SAC) that ensures proper chromosome alignment and segregation during mitosis. By inhibiting Mps1, AZ3146 disrupts SAC signaling, leading to mitotic progression errors and potential cell death in dividing cells. This compound is particularly valuable in oncology research, where it supports studies on cancer cell proliferation, chromosome instability, and the development of targeted therapies. AZ3146 is an essential tool for exploring Mps1’s role in mitotic regulation and advancing drug discovery aimed at mitotic checkpoint inhibition.
| Catalog Number | I000469 |
| CAS Number | 1124329-14-1 |
| Synonyms | 9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)oxyanilino]-7-methylpurin-8-one |
| Molecular Formula | C₂₄H₃₂N₆O₃ |
| Purity | ≥95% |
| Target | Cytoskeleton |
| Solubility | DMSO: ≤ 11.75 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 35 nM |
| IUPAC Name | 9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)oxyanilino]-7-methylpurin-8-one |
| InChI | 1S/C24H32N6O3/c1-28-12-10-17(11-13-28)33-18-8-9-19(21(14-18)32-3)26-23-25-15-20-22(27-23)30(24(31)29(20)2)16-6-4-5-7-16/h8-9,14-17H,4-7,10-13H2,1-3H3,(H,25,26,27) |
| InChIKey | YUKWVHPTFRQHMF-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)OC2=CC(=C(C=C2)NC3=NC=C4C(=N3)N(C(=O)N4C)C5CCCC5)OC |
