For research use only. Not for therapeutic Use.
Az-Dcme (Cat No.:I003865), also known as CS-92, is an antiviral nucleoside analog and a potent, selective, orally active HIV-1 reverse transcriptase and HIV Inhibitor of -1 replication. AzddMeC has EC50 values of 9 nM and 6 nM in HIV-1-infected human PBM cells and HIV-1-infected human macrophages, respectively.
| Catalog Number | I003865 |
| CAS Number | 87190-79-2 |
| Synonyms | Az-Dcme; CS-92; AzddMeC; Azidodideoxymethylcytidine; 3/’-Azido-2/’,3/’-dideoxy-5-methylcytidine;4-amino-1-((2R,4S,5S)-4-azido-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-methylpyrimidin-2(1H)-one |
| Molecular Formula | C10H14N6O3 |
| Purity | ≥95% |
| Target | DNA polymerase inhibitor |
| Solubility | Soluble in DMSO |
| Storage | 4°C, away from moisture |
| IUPAC Name | 4-amino-1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
| InChI | InChI=1S/C10H14N6O3/c1-5-3-16(10(18)13-9(5)11)8-2-6(14-15-12)7(4-17)19-8/h3,6-8,17H,2,4H2,1H3,(H2,11,13,18)/t6-,7+,8+/m0/s1 |
| InChIKey | GZSDAHQGNUAEBC-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)N=C1N)C2CC(C(O2)CO)N=[N+]=[N-] |
| Reference | </br> 1: Schinazi RF, Schlueter-Wirtz S, Stuyver L. Early detection of mixed mutations selected by antiretroviral agents in HIV-infected primary human lymphocytes. Antivir Chem Chemother. 2001;12 Suppl 1:61-5. PubMed PMID: 11594690.</br>2: Boudinot FD, S |
