For research use only. Not for therapeutic Use.
AZ10397767 is a potent CXCR2 antagonist (IC50 = 1 nM). AZ10397767 significantly reduced the numbers of infiltrating neutrophils into both in vitro and in vivo tumor models, which was associated with slower growing tumors. AZ10397767 increased 17-AAG-induc
| Catalog Number | I003353 |
| CAS Number | 333742-63-5 |
| Synonyms | AZ-10397767; AZ 10397767; AZ10397767.;5-[[(3-Chloro-2-fluorophenyl)methyl]thio]-7-[[(1R)-2-hydroxy-1-methylethyl]amino]thiazolo[4,5-d]pyrimidin-2(3H)-one |
| Molecular Formula | C15H14ClFN4O2S2 |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| IC50 | IC50 = 1 nM |
| IUPAC Name | 5-[(3-chloro-2-fluorophenyl)methylsulfanyl]-7-[[(2R)-1-hydroxypropan-2-yl]amino]-3H-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| InChI | InChI=1S/C15H14ClFN4O2S2/c1-7(5-22)18-12-11-13(21-15(23)25-11)20-14(19-12)24-6-8-3-2-4-9(16)10(8)17/h2-4,7,22H,5-6H2,1H3,(H2,18,19,20,21,23)/t7-/m1/s1 |
| InChIKey | KHTUORKUWBDRBX-SSDOTTSWSA-N |
| SMILES | CC(CO)NC1=NC(=NC2=C1SC(=O)N2)SCC3=C(C(=CC=C3)Cl)F |
| Reference | </br>1: Tazzyman S, Barry ST, Ashton S, Wood P, Blakey D, Lewis CE, Murdoch C. Inhibition of neutrophil infiltration into A549 lung tumors in vitro and in vivo using a CXCR2-specific antagonist is associated with reduced tumor growth. Int J Cancer. 2011 |
