For research use only. Not for therapeutic Use.
AZ12672857 is a small-molecule inhibitor primarily studied for its role in targeting specific enzymes or receptors involved in disease pathways, particularly in the context of cancer or inflammatory conditions. While the detailed mechanism of action and specific targets of AZ12672857 may not be widely documented, compounds like this are typically designed to interfere with signaling pathways that contribute to the progression of diseases. Research involving AZ12672857 focuses on evaluating its efficacy, selectivity, and potential therapeutic benefits in preclinical or clinical settings.
| Catalog Number | I010665 |
| CAS Number | 945396-55-4 |
| Synonyms | 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indazol-4-yl)-4-N-methylpyrimidine-2,4-diamine |
| Molecular Formula | C26H30N8O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C26H30N8O2/c1-32(24-4-2-3-23-22(24)18-28-31-23)25-5-6-27-26(30-25)29-19-15-20(33-7-11-35-12-8-33)17-21(16-19)34-9-13-36-14-10-34/h2-6,15-18H,7-14H2,1H3,(H,28,31)(H,27,29,30) |
| InChIKey | QLFGDTPACJHLRY-UHFFFAOYSA-N |
| SMILES | CN(C1=NC(=NC=C1)NC2=CC(=CC(=C2)N3CCOCC3)N4CCOCC4)C5=CC=CC6=C5C=NN6 |
