For research use only, not for therapeutic use.
AZ304（Cat No.:I019444）is a potent and selective inhibitor of the receptor tyrosine kinase RET (rearranged during transfection), which plays a critical role in cell growth, differentiation, and survival. RET mutations are often implicated in cancers such as medullary thyroid carcinoma and non-small cell lung cancer. AZ304 is used in cancer research to study RET-driven signaling pathways and to evaluate its therapeutic potential in targeting RET mutations. Its specificity makes it a valuable tool for exploring RET-related oncogenesis and developing novel targeted cancer therapies.
| Catalog Number | I019444 |
| CAS Number | 942507-42-8 |
| Molecular Formula | C₂₇H₂₅N₅O₂ |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 3-(2-cyanopropan-2-yl)-N-[3-[(7-methoxyquinazolin-4-yl)amino]-4-methylphenyl]benzamide |
| InChI | InChI=1S/C27H25N5O2/c1-17-8-9-20(31-26(33)18-6-5-7-19(12-18)27(2,3)15-28)13-23(17)32-25-22-11-10-21(34-4)14-24(22)29-16-30-25/h5-14,16H,1-4H3,(H,31,33)(H,29,30,32) |
| InChIKey | NGWQZRWVYYFTHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)C(C)(C)C#N)NC3=NC=NC4=C3C=CC(=C4)OC |
| Reference | [1]. Ma R, et al. AZ304, a novel dual BRAF inhibitor, exerts anti-tumour effects in colorectal cancer independently of BRAF genetic status. Br J Cancer. 2018 May;118(11):1453-1463. |
