For research use only. Not for therapeutic Use.
AZ8838（Cat No.:I022814）is an investigational small molecule being studied for its potential therapeutic applications, particularly in oncology. It is designed to inhibit specific enzymes or signaling pathways involved in tumor growth, survival, and metastasis. By targeting these pathways, AZ8838 aims to disrupt cancer cell proliferation and resistance to cell death. Ongoing research is focused on evaluating its efficacy, safety, and potential clinical benefits in various cancer types, including solid tumors. If successful, AZ8838 could provide a novel treatment option for patients with cancers that are resistant to traditional therapies or have limited treatment options.
| CAS Number | 2100285-41-2 |
| Synonyms | (S)-(4-fluoro-2-propylphenyl)-(1H-imidazol-2-yl)methanol |
| Molecular Formula | C13H15FN2O |
| Purity | ≥95% |
| IUPAC Name | (S)-(4-fluoro-2-propylphenyl)-(1H-imidazol-2-yl)methanol |
| InChI | InChI=1S/C13H15FN2O/c1-2-3-9-8-10(14)4-5-11(9)12(17)13-15-6-7-16-13/h4-8,12,17H,2-3H2,1H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | IDFPQEHZYBXIFO-LBPRGKRZSA-N |
| SMILES | CCCC1=C(C=CC(=C1)F)[C@@H](C2=NC=CN2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
