For research use only. Not for therapeutic Use.
Azaperone（Cat No.:A000940） is an antipsychotic medication primarily used in veterinary medicine as a tranquilizer and sedative. It is commonly administered to pigs to reduce stress during handling, transportation, and medical procedures. Azaperone works by blocking dopamine receptors in the brain, leading to a calming effect and muscle relaxation. Its rapid onset and effectiveness in minimizing aggression and anxiety make it valuable in livestock management. While its use is mainly in animals, Azaperone’s pharmacological properties have been studied for potential applications in human medicine, particularly for managing agitation and psychotic disorders.
| Catalog Number | A000940 |
| CAS Number | 1649-18-9 |
| Synonyms | 1-(4-fluorophenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)butan-1-one |
| Molecular Formula | C19H22FN3O |
| Purity | ≥95% |
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)butan-1-one |
| InChI | InChI=1S/C19H22FN3O/c20-17-8-6-16(7-9-17)18(24)4-3-11-22-12-14-23(15-13-22)19-5-1-2-10-21-19/h1-2,5-10H,3-4,11-15H2 |
| InChIKey | XTKDAFGWCDAMPY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCC(=O)C2=CC=C(C=C2)F)C3=CC=CC=N3 |
