For research use only. Not for therapeutic Use.
Azaquinzole (CAT: I022838) is a synthetic compound with diverse applications in chemical synthesis and pharmaceutical research. It serves as a versatile building block for the creation of various organic molecules due to its unique structure and reactivity. Researchers utilize azaquinzole as a key intermediate in the preparation of novel compounds with potential biological activities. Its strategic incorporation can lead to the development of new drugs, agrochemicals, and materials with improved properties.
| Catalog Number | I022838 |
| CAS Number | 5234-86-6 |
| Synonyms | Azaquinzole |
| Molecular Formula | C12H16N2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1,3,4,6,7,11b-Hexahydro-2H-pyrazino(2,1-a)isoquinoline |
| InChI | InChI=1S/C12H16N2/c1-2-4-11-10(3-1)5-7-14-8-6-13-9-12(11)14/h1-4,12-13H,5-9H2 |
| InChIKey | SCVCXWHEHAKJCG-UHFFFAOYSA-N |
| SMILES | C1CN2CCc3ccccc3C2CN1 |
