For research use only. Not for therapeutic Use.
Azasetron HCl is a selective serotonin 5-HT3 receptor antagonist primarily used to prevent nausea and vomiting associated with chemotherapy and postoperative recovery. Its structure contains a nitrogen atom in the azabicyclic framework, contributing to its pharmacological activity. Azasetron effectively blocks the action of serotonin at these receptors, providing relief for patients undergoing treatments that induce gastrointestinal distress. This compound is also explored for potential applications in treating other conditions related to serotonin signaling, highlighting its significance in pharmacotherapy.
| Catalog Number | A001172 |
| CAS Number | 123040-16-4 |
| Synonyms | Y-25130 HCl |
| Molecular Formula | C17H20ClN3O3.HCl |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| InChI | 1S/C17H20ClN3O3.ClH/c1-20-14-7-11(18)6-12(16(14)24-9-15(20)22)17(23)19-13-8-21-4-2-10(13)3-5-21;/h6-7,10,13H,2-5,8-9H2,1H3,(H,19,23);1H |
| InChIKey | DBMKBKPJYAHLQP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C(C=C(C=C21)Cl)C(=O)NC3CN4CCC3CC4.Cl |
