For research use only. Not for therapeutic Use.
Azatadine dimaleate(CAT: I003451) is a second-generation antihistamine drug that is used to treat various allergic conditions, such as seasonal allergies, allergic rhinitis, and urticaria. It works by selectively blocking the histamine H1 receptor, which is responsible for mediating allergic symptoms such as itching, sneezing, and runny nose. Azatadine dimaleate also has some anticholinergic and sedative properties, which may contribute to its therapeutic effects. It is commonly available in the form of tablets or syrups for oral administration. Azatadine dimaleate is generally well-tolerated but may cause some side effects such as drowsiness, dry mouth, and dizziness.
| Catalog Number | I003451 |
| CAS Number | 3978-86-7 |
| Synonyms | (Z)-but-2-enedioic acid;11-(1-methylpiperidin-4-ylidene)-5,6-dihydrobenzo[1,2]cyclohepta[3,4-b]pyridine |
| Molecular Formula | C28H30N2O8 |
| Purity | ≥95% |
| Target | Histamine Receptor |
| Solubility | DMSO 105 mg/mL (200 mM); Water 105 mg/mL (200 mM) |
| Storage | Store at -20°C |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
| InChI | InChI=1S/C20H22N2.2C4H4O4/c1-22-13-10-16(11-14-22)19-18-7-3-2-5-15(18)8-9-17-6-4-12-21-20(17)19;2*5-3(6)1-2-4(7)8/h2-7,12H,8-11,13-14H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | SGHXFFAHXTZRQM-SPIKMXEPSA-N |
| SMILES | CN1CC/C(CC1)=C2C3=CC=CC=C3CCC4=CC=CN=C42.O=C(O)/C=CC(O)=O.O=C(O)/C=CC(O)=O |
| Reference | 1: Hata K, Takagi M, Koga K, Shigematsu A. Stability of tritium-labelled azatadine dimaleate [6,11-dihydro-11 (1-methyl-4-piperidylidine)5H-benzo (5, 6) cyclohepta (1,2-b) pyridine dimaleate] of high specific activity. Radioisotopes. 1977 Jan;26(1):33-5. PubMed PMID: 577021.<br /> |
