For research use only. Not for therapeutic Use.
Azathioprine (Cat No.: I003581) is one of the derivatives of the chemical compound 6-mercaptopurine, which belongs to immunosuppressive drugs. It is a derivative of mercaptopurine, which can be decomposed into mercaptopurine in the body to work. It is mainly used to suppress immune rejection during allogeneic transplantation, and it is mostly used in combination with corticosteroids.
| CAS Number | 446-86-6 |
| Synonyms | 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-7H-purine |
| Molecular Formula | C9H7N7O2S |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | DMSO 55 mg/mL; Water <1 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-7H-purine |
| InChI | InChI=1S/C9H7N7O2S/c1-15-4-14-7(16(17)18)9(15)19-8-5-6(11-2-10-5)12-3-13-8/h2-4H,1H3,(H,10,11,12,13) |
| InChIKey | LMEKQMALGUDUQG-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1SC2=NC=NC3=C2NC=N3)[N+](=O)[O-] |
