For research use only. Not for therapeutic Use.
AZD 3988 (Cat.No:I011037) is a potent and selective diacylglycerol acyltransferase (DGAT-1) inhibitor (IC<sub>50</sub> = 0.6 nM). Exhibits selectivity for DGAT-1 over DGAT-2, K<sub>v</sub>11.1 (hERG) and cytochrome P450 enzymes. Suppresses triacylglyceride (TAG) plasma excursion and adipose tissue TAG synthesis in rats. Reduces body weight of diet-induced obese rats. Cell permeable and orally bioavailable.
| Catalog Number | I011037 |
| CAS Number | 892489-52-0 |
| Synonyms | trans-4-[-[[[5-[(3,4-Difluorophenyl)amino]-1,3,4-oxadiazol-2-yl]carbonyl]amino]phenyl]cyclohexaneacetic acid |
| Molecular Formula | C23H22F2N4O4 |
| Purity | ≥95% |
| Target | Acyltransferase |
| Solubility | Soluble to 100 mM in DMSO and to 10 mM in 1eq. NaOH with gentle warming |
| Storage | Store at 4℃ |
| IUPAC Name | 2-[4-[4-[[5-(3,4-difluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid |
| InChI | InChI=1S/C23H22F2N4O4/c24-18-10-9-17(12-19(18)25)27-23-29-28-22(33-23)21(32)26-16-7-5-15(6-8-16)14-3-1-13(2-4-14)11-20(30)31/h5-10,12-14H,1-4,11H2,(H,26,32)(H,27,29)(H,30,31) |
| InChIKey | NGEBYTLALFOQKI-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CC(=O)O)C2=CC=C(C=C2)NC(=O)C3=NN=C(O3)NC4=CC(=C(C=C4)F)F |
