For research use only. Not for therapeutic Use.
AZD5904 is a potent orally bioavailable MPO inhibitor. In preclinical studies, AZD5904 inhibited the isolated MPO enzyme with an IC50 of 140 nM and was approximately equipotent in assays of rat and mouse MPO enzyme activity. Cross over to other species ha
| Catalog Number | I003737 |
| CAS Number | 618913-30-7 |
| Synonyms | AZ1, AZ 1 AZ-1; TX4; TX-4; TX 4; AZD-5904; AZD 5904; AZD5904.;(S)-3-((tetrahydrofuran-2-yl)methyl)-2-thioxo-1,2,3,7-tetrahydro-6H-purin-6-one |
| Molecular Formula | C10H12N4O2S |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| IUPAC Name | 3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-7H-purin-6-one |
| InChI | InChI=1S/C10H12N4O2S/c15-9-7-8(12-5-11-7)14(10(17)13-9)4-6-2-1-3-16-6/h5-6H,1-4H2,(H,11,12)(H,13,15,17)/t6-/m1/s1 |
| InChIKey | RSPDBEVKURKEII-ZCFIWIBFSA-N |
| SMILES | C1CC(OC1)CN2C3=C(C(=O)NC2=S)NC=N3 |
| Reference | </br>1. Ruggeri RB, Buckbinder L, Bagley SW, Carpino PA, Conn EL, Dowling MS, Fernando DP, Jiao W, Kung DW, Orr ST, Qi Y, Rocke BN, Smith A, Warmus JS, Zhang Y, Bowles D, Widlicka DW, Eng H, Ryder T, Sharma R, Wolford A, Okerberg C, Walters K, Maurer TS |
